C17H33BrOSi — CID 142633715
[3-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-(2,2-dimethylpropyl)-methylsilane (PubChem CID 142633715) has the molecular formula C17H33BrOSi and a molecular weight of 361.44 g/mol. Its IUPAC name is [3-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-(2,2-dimethylpropyl)-methylsilane.
| Compound Name | [3-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-(2,2-dimethylpropyl)-methylsilane |
|---|---|
| PubChem CID | 142633715 |
| Molecular Formula | C17H33BrOSi |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [3-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-(2,2-dimethylpropyl)-methylsilane |
| SMILES | CC(C)(C)C[Si](C)(OCC1C=C(CBr)CC1)C(C)(C)C |
| InChI | InChI=1S/C17H33BrOSi/c1-16(2,3)13-20(7,17(4,5)6)19-12-15-9-8-14(10-15)11-18/h10,15H,8-9,11-13H2,1-7H3 |
| InChIKey | YOLJEMJEFGSQJD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|