C16H33BrOSi — CID 11110873
[(Z)-8-bromo-3,7-dimethyloct-6-enoxy]-tert-butyl-dimethylsilane (PubChem CID 11110873) has the molecular formula C16H33BrOSi and a molecular weight of 349.43 g/mol. Its IUPAC name is [(Z)-8-bromo-3,7-dimethyloct-6-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(Z)-8-bromo-3,7-dimethyloct-6-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11110873 |
| Molecular Formula | C16H33BrOSi |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [(Z)-8-bromo-3,7-dimethyloct-6-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C/C(=C/CCC(C)CCO[Si](C)(C)C(C)(C)C)CBr |
| InChI | InChI=1S/C16H33BrOSi/c1-14(9-8-10-15(2)13-17)11-12-18-19(6,7)16(3,4)5/h10,14H,8-9,11-13H2,1-7H3/b15-10- |
| InChIKey | NUGNDCWFECXBDV-GDNBJRDFSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|