C14H17F2NO2 — CID 104967616
4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3,5-difluorobenzoic acid (PubChem CID 104967616) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3,5-difluorobenzoic acid.
| Compound Name | 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 104967616 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-3,5-difluorobenzoic acid |
| SMILES | C[C@@H]1CCC[C@H](C)N1c1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C14H17F2NO2/c1-8-4-3-5-9(2)17(8)13-11(15)6-10(14(18)19)7-12(13)16/h6-9H,3-5H2,1-2H3,(H,18,19)/t8-,9+ |
| InChIKey | JJRAIKGMAIXUID-DTORHVGOSA-N |
| XLogP | 3.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |