C17H20N2O5 — CID 10496783
ethyl (2E)-2-[(4S)-1-methyl-5-oxo-4-(phenylmethoxycarbonylamino)pyrrolidin-2-ylidene]acetate (PubChem CID 10496783) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl (2E)-2-[(4S)-1-methyl-5-oxo-4-(phenylmethoxycarbonylamino)pyrrolidin-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(4S)-1-methyl-5-oxo-4-(phenylmethoxycarbonylamino)pyrrolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 10496783 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl (2E)-2-[(4S)-1-methyl-5-oxo-4-(phenylmethoxycarbonylamino)pyrrolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C[C@H](NC(=O)OCc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C17H20N2O5/c1-3-23-15(20)10-13-9-14(16(21)19(13)2)18-17(22)24-11-12-7-5-4-6-8-12/h4-8,10,14H,3,9,11H2,1-2H3,(H,18,22)/b13-10+/t14-/m0/s1 |
| InChIKey | VUFBKDZCODFAAY-UELRPHRMSA-N |
| XLogP | 1.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|