C12H24N4O3S — CID 104978329
1-(cyclopropylsulfamoylamino)-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide (PubChem CID 104978329) has the molecular formula C12H24N4O3S and a molecular weight of 304.42 g/mol. Its IUPAC name is 1-(cyclopropylsulfamoylamino)-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide.
| Compound Name | 1-(cyclopropylsulfamoylamino)-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 104978329 |
| Molecular Formula | C12H24N4O3S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-(cyclopropylsulfamoylamino)-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide |
| SMILES | CCC1CCC(NS(=O)(=O)NC2CC2)(C(N)=NO)CC1 |
| InChI | InChI=1S/C12H24N4O3S/c1-2-9-5-7-12(8-6-9,11(13)14-17)16-20(18,19)15-10-3-4-10/h9-10,15-17H,2-8H2,1H3,(H2,13,14) |
| InChIKey | LIRYHSNAJFIXMF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|