C20H14N2O2S2 — CID 10499889
2-(1,3-benzodioxol-5-ylmethylsulfanyl)-3-thiophen-2-ylquinoxaline (PubChem CID 10499889) has the molecular formula C20H14N2O2S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylsulfanyl)-3-thiophen-2-ylquinoxaline.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylsulfanyl)-3-thiophen-2-ylquinoxaline |
|---|---|
| PubChem CID | 10499889 |
| Molecular Formula | C20H14N2O2S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylsulfanyl)-3-thiophen-2-ylquinoxaline |
| SMILES | c1csc(-c2nc3ccccc3nc2SCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C20H14N2O2S2/c1-2-5-15-14(4-1)21-19(18-6-3-9-25-18)20(22-15)26-11-13-7-8-16-17(10-13)24-12-23-16/h1-10H,11-12H2 |
| InChIKey | VUPLFJCGXKVKIV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |