C18H23F3O3S2 — CID 10501605
(2-ethoxy-1,1,1-trifluoro-6,6-dimethyl-2-methylsulfanylhepta-3,4-dien-3-yl)sulfonylbenzene (PubChem CID 10501605) has the molecular formula C18H23F3O3S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is (2-ethoxy-1,1,1-trifluoro-6,6-dimethyl-2-methylsulfanylhepta-3,4-dien-3-yl)sulfonylbenzene.
| Compound Name | (2-ethoxy-1,1,1-trifluoro-6,6-dimethyl-2-methylsulfanylhepta-3,4-dien-3-yl)sulfonylbenzene |
|---|---|
| PubChem CID | 10501605 |
| Molecular Formula | C18H23F3O3S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (2-ethoxy-1,1,1-trifluoro-6,6-dimethyl-2-methylsulfanylhepta-3,4-dien-3-yl)sulfonylbenzene |
| SMILES | CCOC(SC)(C(=C=CC(C)(C)C)S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H23F3O3S2/c1-6-24-17(25-5,18(19,20)21)15(12-13-16(2,3)4)26(22,23)14-10-8-7-9-11-14/h7-11,13H,6H2,1-5H3 |
| InChIKey | PBBPLAHDKRZEDI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|