C26H46O2Si — CID 10502149
(1S,4aR,4bR,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1,4b,8,8-tetramethyl-1,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-4-ol (PubChem CID 10502149) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is (1S,4aR,4bR,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1,4b,8,8-tetramethyl-1,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-4-ol.
| Compound Name | (1S,4aR,4bR,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1,4b,8,8-tetramethyl-1,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-4-ol |
|---|---|
| PubChem CID | 10502149 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (1S,4aR,4bR,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1,4b,8,8-tetramethyl-1,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-4-ol |
| SMILES | C=CC1=CC(O)[C@@H]2[C@H](CC[C@@H]3C(C)(C)[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@]23C)[C@@H]1C |
| InChI | InChI=1S/C26H46O2Si/c1-11-18-16-20(27)23-19(17(18)2)12-13-21-25(6,7)22(14-15-26(21,23)8)28-29(9,10)24(3,4)5/h11,16-17,19-23,27H,1,12-15H2,2-10H3/t17-,19-,20?,21-,22-,23+,26-/m1/s1 |
| InChIKey | XULHAIVCSHSXFN-JWMRYIGOSA-N |
| XLogP | 6.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|