C23H37NOSe — CID 10502346
(1R,2S,5R)-5-methyl-2-[2-[3-methylbut-2-enyl(2-phenylselanylethyl)amino]propan-2-yl]cyclohexan-1-ol (PubChem CID 10502346) has the molecular formula C23H37NOSe and a molecular weight of 422.52 g/mol. Its IUPAC name is (1R,2S,5R)-5-methyl-2-[2-[3-methylbut-2-enyl(2-phenylselanylethyl)amino]propan-2-yl]cyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-5-methyl-2-[2-[3-methylbut-2-enyl(2-phenylselanylethyl)amino]propan-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10502346 |
| Molecular Formula | C23H37NOSe |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (1R,2S,5R)-5-methyl-2-[2-[3-methylbut-2-enyl(2-phenylselanylethyl)amino]propan-2-yl]cyclohexan-1-ol |
| SMILES | CC(C)=CCN(CC[Se]c1ccccc1)C(C)(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C23H37NOSe/c1-18(2)13-14-24(15-16-26-20-9-7-6-8-10-20)23(4,5)21-12-11-19(3)17-22(21)25/h6-10,13,19,21-22,25H,11-12,14-17H2,1-5H3/t19-,21-,22-/m1/s1 |
| InChIKey | MHHYDMPKVXVMSA-CEMLEFRQSA-N |
| XLogP | 4.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|