C14H20ClF2N — CID 105028716
1-(4-chloro-2,5-difluorophenyl)-N,5-dimethylhexan-1-amine (PubChem CID 105028716) has the molecular formula C14H20ClF2N and a molecular weight of 275.77 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-N,5-dimethylhexan-1-amine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-N,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 105028716 |
| Molecular Formula | C14H20ClF2N |
| Molecular Weight | 275.77 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-N,5-dimethylhexan-1-amine |
| SMILES | CNC(CCCC(C)C)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C14H20ClF2N/c1-9(2)5-4-6-14(18-3)10-7-13(17)11(15)8-12(10)16/h7-9,14,18H,4-6H2,1-3H3 |
| InChIKey | ULTSKTGPCBUBRK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.77 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|