C15H20O4S6 — CID 10504016
dimethyl 2-[2-(propan-2-yldisulfanyl)-1-propan-2-ylsulfanyl-2-sulfanylideneethylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 10504016) has the molecular formula C15H20O4S6 and a molecular weight of 456.72 g/mol. Its IUPAC name is dimethyl 2-[2-(propan-2-yldisulfanyl)-1-propan-2-ylsulfanyl-2-sulfanylideneethylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2-(propan-2-yldisulfanyl)-1-propan-2-ylsulfanyl-2-sulfanylideneethylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10504016 |
| Molecular Formula | C15H20O4S6 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 455.97 |
| IUPAC Name | dimethyl 2-[2-(propan-2-yldisulfanyl)-1-propan-2-ylsulfanyl-2-sulfanylideneethylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C(SC(C)C)C(=S)SSC(C)C)S1 |
| InChI | InChI=1S/C15H20O4S6/c1-7(2)21-11(14(20)25-24-8(3)4)15-22-9(12(16)18-5)10(23-15)13(17)19-6/h7-8H,1-6H3 |
| InChIKey | IQWBFYSGNMBQKZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|