C10H17ClN2O2S — CID 105055848
4-chloro-N-[(1-methylpyrrol-2-yl)methyl]butane-1-sulfonamide (PubChem CID 105055848) has the molecular formula C10H17ClN2O2S and a molecular weight of 264.78 g/mol. Its IUPAC name is 4-chloro-N-[(1-methylpyrrol-2-yl)methyl]butane-1-sulfonamide.
| Compound Name | 4-chloro-N-[(1-methylpyrrol-2-yl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 105055848 |
| Molecular Formula | C10H17ClN2O2S |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-chloro-N-[(1-methylpyrrol-2-yl)methyl]butane-1-sulfonamide |
| SMILES | Cn1cccc1CNS(=O)(=O)CCCCCl |
| InChI | InChI=1S/C10H17ClN2O2S/c1-13-7-4-5-10(13)9-12-16(14,15)8-3-2-6-11/h4-5,7,12H,2-3,6,8-9H2,1H3 |
| InChIKey | XKZSSSCKLKOQSP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|