C29H56O5Si — CID 10505943
ethyl (2R)-2-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]propanoate (PubChem CID 10505943) has the molecular formula C29H56O5Si and a molecular weight of 512.85 g/mol. Its IUPAC name is ethyl (2R)-2-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]propanoate.
| Compound Name | ethyl (2R)-2-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]propanoate |
|---|---|
| PubChem CID | 10505943 |
| Molecular Formula | C29H56O5Si |
| Molecular Weight | 512.85 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | ethyl (2R)-2-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]propanoate |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@H]1OC(C)(C)O[C@@H]([C@@H](C)C(=O)OCC)C1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H56O5Si/c1-14-16-17-18-23(34-35(12,13)27(5,6)7)20-19-21(3)24-28(8,9)25(33-29(10,11)32-24)22(4)26(30)31-15-2/h19,22-25H,14-18,20H2,1-13H3/b21-19+/t22-,23-,24-,25+/m1/s1 |
| InChIKey | QULINTVLUVZSRU-USYFOGOPSA-N |
| XLogP | 8.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.85 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|