C33H40N2O7 — CID 10507395
ethyl (3R,6R,7S,7aS)-6-(1-benzyl-2-oxopiperidin-3-yl)-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 10507395) has the molecular formula C33H40N2O7 and a molecular weight of 576.69 g/mol. Its IUPAC name is ethyl (3R,6R,7S,7aS)-6-(1-benzyl-2-oxopiperidin-3-yl)-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | ethyl (3R,6R,7S,7aS)-6-(1-benzyl-2-oxopiperidin-3-yl)-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 10507395 |
| Molecular Formula | C33H40N2O7 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | ethyl (3R,6R,7S,7aS)-6-(1-benzyl-2-oxopiperidin-3-yl)-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | CCOC(=O)[C@]1(C2CCCN(Cc3ccccc3)C2=O)C(=O)N2[C@@H](c3ccccc3)OC[C@@H]2[C@H]1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H40N2O7/c1-5-40-31(39)33(24-17-12-18-34(28(24)37)20-22-13-8-6-9-14-22)25(19-27(36)42-32(2,3)4)26-21-41-29(35(26)30(33)38)23-15-10-7-11-16-23/h6-11,13-16,24-26,29H,5,12,17-21H2,1-4H3/t24?,25-,26-,29-,33+/m1/s1 |
| InChIKey | NYARMWDMOHXFEH-NHCQMQIGSA-N |
| XLogP | 4.26 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|