C28H25NO6 — CID 138978766
5-O-benzyl 4-O-methyl (3aR,4S,6S,6aS)-2-oxo-3a,6-diphenyl-3,4,6,6a-tetrahydrofuro[2,3-c]pyrrole-4,5-dicarboxylate (PubChem CID 138978766) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is 5-O-benzyl 4-O-methyl (3aR,4S,6S,6aS)-2-oxo-3a,6-diphenyl-3,4,6,6a-tetrahydrofuro[2,3-c]pyrrole-4,5-dicarboxylate.
| Compound Name | 5-O-benzyl 4-O-methyl (3aR,4S,6S,6aS)-2-oxo-3a,6-diphenyl-3,4,6,6a-tetrahydrofuro[2,3-c]pyrrole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 138978766 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 5-O-benzyl 4-O-methyl (3aR,4S,6S,6aS)-2-oxo-3a,6-diphenyl-3,4,6,6a-tetrahydrofuro[2,3-c]pyrrole-4,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1N(C(=O)OCc2ccccc2)[C@@H](c2ccccc2)[C@H]2OC(=O)C[C@]21c1ccccc1 |
| InChI | InChI=1S/C28H25NO6/c1-33-26(31)24-28(21-15-9-4-10-16-21)17-22(30)35-25(28)23(20-13-7-3-8-14-20)29(24)27(32)34-18-19-11-5-2-6-12-19/h2-16,23-25H,17-18H2,1H3/t23-,24+,25+,28+/m0/s1 |
| InChIKey | OHMSYUNYAFPBEP-XVOBZGQLSA-N |
| XLogP | 4.18 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|