C28H33NO8 — CID 15352799
trimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-phenylpyrrolidine-2,3,4-tricarboxylate (PubChem CID 15352799) has the molecular formula C28H33NO8 and a molecular weight of 511.57 g/mol. Its IUPAC name is trimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-phenylpyrrolidine-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-phenylpyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 15352799 |
| Molecular Formula | C28H33NO8 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | trimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-phenylpyrrolidine-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(=O)OC)[C@@H](c2ccccc2)N([C@H]2COC(C)(C)O[C@H]2c2ccccc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C28H33NO8/c1-28(2)36-16-19(24(37-28)18-14-10-7-11-15-18)29-22(17-12-8-6-9-13-17)20(25(30)33-3)21(26(31)34-4)23(29)27(32)35-5/h6-15,19-24H,16H2,1-5H3/t19-,20-,21-,22+,23-,24-/m0/s1 |
| InChIKey | IVUWPCWMZXHEGX-WMGXJHCHSA-N |
| XLogP | 3.06 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|