C28H32FNO8 — CID 15352813
trimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-(4-fluorophenyl)pyrrolidine-2,3,4-tricarboxylate (PubChem CID 15352813) has the molecular formula C28H32FNO8 and a molecular weight of 529.56 g/mol. Its IUPAC name is trimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-(4-fluorophenyl)pyrrolidine-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-(4-fluorophenyl)pyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 15352813 |
| Molecular Formula | C28H32FNO8 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | trimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-(4-fluorophenyl)pyrrolidine-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(=O)OC)[C@@H](c2ccc(F)cc2)N([C@H]2COC(C)(C)O[C@H]2c2ccccc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C28H32FNO8/c1-28(2)37-15-19(24(38-28)17-9-7-6-8-10-17)30-22(16-11-13-18(29)14-12-16)20(25(31)34-3)21(26(32)35-4)23(30)27(33)36-5/h6-14,19-24H,15H2,1-5H3/t19-,20-,21-,22+,23-,24-/m0/s1 |
| InChIKey | VNMLMDOHICABBE-WMGXJHCHSA-N |
| XLogP | 3.20 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|