C25H27NO6 — CID 134971040
dimethyl (4S,6S,7S,8S)-4,6-dimethyl-1-oxo-4,6-diphenyl-3,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate (PubChem CID 134971040) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is dimethyl (4S,6S,7S,8S)-4,6-dimethyl-1-oxo-4,6-diphenyl-3,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate.
| Compound Name | dimethyl (4S,6S,7S,8S)-4,6-dimethyl-1-oxo-4,6-diphenyl-3,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 134971040 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | dimethyl (4S,6S,7S,8S)-4,6-dimethyl-1-oxo-4,6-diphenyl-3,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C2C(=O)OC[C@](C)(c3ccccc3)N2[C@](C)(c2ccccc2)[C@H]1C(=O)OC |
| InChI | InChI=1S/C25H27NO6/c1-24(16-11-7-5-8-12-16)15-32-23(29)20-18(21(27)30-3)19(22(28)31-4)25(2,26(20)24)17-13-9-6-10-14-17/h5-14,18-20H,15H2,1-4H3/t18-,19+,20?,24+,25+/m0/s1 |
| InChIKey | RBAOQADHFHWZBH-WAQPQXQPSA-N |
| XLogP | 2.64 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|