C26H27N3O4 — CID 15352801
methyl (2S,3S,4S,5S)-3,4-dicyano-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-phenylpyrrolidine-2-carboxylate (PubChem CID 15352801) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is methyl (2S,3S,4S,5S)-3,4-dicyano-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5S)-3,4-dicyano-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15352801 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | methyl (2S,3S,4S,5S)-3,4-dicyano-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-5-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C#N)[C@H](C#N)[C@@H](c2ccccc2)N1[C@H]1COC(C)(C)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H27N3O4/c1-26(2)32-16-21(24(33-26)18-12-8-5-9-13-18)29-22(17-10-6-4-7-11-17)19(14-27)20(15-28)23(29)25(30)31-3/h4-13,19-24H,16H2,1-3H3/t19-,20-,21-,22+,23-,24-/m0/s1 |
| InChIKey | MEKHFQYPUHJUEW-WMGXJHCHSA-N |
| XLogP | 3.76 |
| TPSA | 95.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |