C22H22N2O2 — CID 134971041
(4S,6S,7S)-4,6-dimethyl-1-oxo-4,6-diphenyl-3,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7-carbonitrile (PubChem CID 134971041) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (4S,6S,7S)-4,6-dimethyl-1-oxo-4,6-diphenyl-3,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7-carbonitrile.
| Compound Name | (4S,6S,7S)-4,6-dimethyl-1-oxo-4,6-diphenyl-3,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7-carbonitrile |
|---|---|
| PubChem CID | 134971041 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (4S,6S,7S)-4,6-dimethyl-1-oxo-4,6-diphenyl-3,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7-carbonitrile |
| SMILES | C[C@]1(c2ccccc2)COC(=O)C2C[C@H](C#N)[C@@](C)(c3ccccc3)N21 |
| InChI | InChI=1S/C22H22N2O2/c1-21(16-9-5-3-6-10-16)15-26-20(25)19-13-18(14-23)22(2,24(19)21)17-11-7-4-8-12-17/h3-12,18-19H,13,15H2,1-2H3/t18-,19?,21-,22-/m1/s1 |
| InChIKey | DXVMBBPWUKQBCD-BAWFOZSCSA-N |
| XLogP | 3.59 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |