C28H27NO5 — CID 138978981
3-O-benzyl 2-O-methyl (1R,2S,4R,5S,6S)-6-hydroxy-1,4-diphenyl-3-azabicyclo[3.2.0]heptane-2,3-dicarboxylate (PubChem CID 138978981) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-O-benzyl 2-O-methyl (1R,2S,4R,5S,6S)-6-hydroxy-1,4-diphenyl-3-azabicyclo[3.2.0]heptane-2,3-dicarboxylate.
| Compound Name | 3-O-benzyl 2-O-methyl (1R,2S,4R,5S,6S)-6-hydroxy-1,4-diphenyl-3-azabicyclo[3.2.0]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 138978981 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 3-O-benzyl 2-O-methyl (1R,2S,4R,5S,6S)-6-hydroxy-1,4-diphenyl-3-azabicyclo[3.2.0]heptane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1N(C(=O)OCc2ccccc2)[C@@H](c2ccccc2)[C@H]2[C@@H](O)C[C@]21c1ccccc1 |
| InChI | InChI=1S/C28H27NO5/c1-33-26(31)25-28(21-15-9-4-10-16-21)17-22(30)23(28)24(20-13-7-3-8-14-20)29(25)27(32)34-18-19-11-5-2-6-12-19/h2-16,22-25,30H,17-18H2,1H3/t22-,23+,24-,25+,28-/m0/s1 |
| InChIKey | JCRDNMFNLAQZFW-BBALPUGFSA-N |
| XLogP | 4.24 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |