C17H19NO6 — CID 135019659
methyl (3S,7S,8R,10S)-10-hydroxy-6,6-dimethyl-5-oxo-1-phenyl-4,9-dioxa-2-azatricyclo[5.2.1.03,8]decane-2-carboxylate (PubChem CID 135019659) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is methyl (3S,7S,8R,10S)-10-hydroxy-6,6-dimethyl-5-oxo-1-phenyl-4,9-dioxa-2-azatricyclo[5.2.1.03,8]decane-2-carboxylate.
| Compound Name | methyl (3S,7S,8R,10S)-10-hydroxy-6,6-dimethyl-5-oxo-1-phenyl-4,9-dioxa-2-azatricyclo[5.2.1.03,8]decane-2-carboxylate |
|---|---|
| PubChem CID | 135019659 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | methyl (3S,7S,8R,10S)-10-hydroxy-6,6-dimethyl-5-oxo-1-phenyl-4,9-dioxa-2-azatricyclo[5.2.1.03,8]decane-2-carboxylate |
| SMILES | COC(=O)N1[C@H]2OC(=O)C(C)(C)[C@@H]3[C@H]2OC1(c1ccccc1)[C@H]3O |
| InChI | InChI=1S/C17H19NO6/c1-16(2)10-11-13(23-14(16)20)18(15(21)22-3)17(24-11,12(10)19)9-7-5-4-6-8-9/h4-8,10-13,19H,1-3H3/t10-,11-,12+,13+,17?/m1/s1 |
| InChIKey | SLVZRWIWKQTELG-PXCWYWECSA-N |
| XLogP | 1.21 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |