C22H22N2O6 — CID 134842833
methyl (3S,6S,7aR)-6-(2-nitro-1-phenylethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 134842833) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is methyl (3S,6S,7aR)-6-(2-nitro-1-phenylethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (3S,6S,7aR)-6-(2-nitro-1-phenylethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 134842833 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | methyl (3S,6S,7aR)-6-(2-nitro-1-phenylethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)[C@]1(C(C[N+](=O)[O-])c2ccccc2)C[C@@H]2CO[C@@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C22H22N2O6/c1-29-21(26)22(18(13-23(27)28)15-8-4-2-5-9-15)12-17-14-30-19(24(17)20(22)25)16-10-6-3-7-11-16/h2-11,17-19H,12-14H2,1H3/t17-,18?,19+,22+/m1/s1 |
| InChIKey | AOPQOQBNRYSWHS-JTOBOTFSSA-N |
| XLogP | 2.54 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|