C17H18N2O4 — CID 56602094
ethyl (3R,6R,7aS)-6-(cyanomethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 56602094) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is ethyl (3R,6R,7aS)-6-(cyanomethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | ethyl (3R,6R,7aS)-6-(cyanomethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 56602094 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethyl (3R,6R,7aS)-6-(cyanomethyl)-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | CCOC(=O)[C@@]1(CC#N)C[C@H]2CO[C@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C17H18N2O4/c1-2-22-16(21)17(8-9-18)10-13-11-23-14(19(13)15(17)20)12-6-4-3-5-7-12/h3-7,13-14H,2,8,10-11H2,1H3/t13-,14+,17-/m0/s1 |
| InChIKey | LQRVHHXPUDXKMZ-VBQJREDUSA-N |
| XLogP | 1.78 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|