C30H30N2O8 — CID 15306424
ethyl (3R,7aR)-7a-[(3R,7aS)-6-ethoxycarbonyl-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]-5-oxo-3-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 15306424) has the molecular formula C30H30N2O8 and a molecular weight of 546.58 g/mol. Its IUPAC name is ethyl (3R,7aR)-7a-[(3R,7aS)-6-ethoxycarbonyl-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]-5-oxo-3-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | ethyl (3R,7aR)-7a-[(3R,7aS)-6-ethoxycarbonyl-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]-5-oxo-3-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 15306424 |
| Molecular Formula | C30H30N2O8 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | ethyl (3R,7aR)-7a-[(3R,7aS)-6-ethoxycarbonyl-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]-5-oxo-3-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | CCOC(=O)C1=CC2(C3C(C(=O)OCC)C(=O)N4[C@@H](c5ccccc5)OC[C@H]34)CO[C@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C30H30N2O8/c1-3-37-28(35)20-15-30(17-40-27(32(30)24(20)33)19-13-9-6-10-14-19)23-21-16-39-26(18-11-7-5-8-12-18)31(21)25(34)22(23)29(36)38-4-2/h5-15,21-23,26-27H,3-4,16-17H2,1-2H3/t21-,22?,23?,26-,27-,30?/m1/s1 |
| InChIKey | NPQGQPNZNWWMLH-SMVSVRBZSA-N |
| XLogP | 2.52 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|