C10H18N2O — CID 105096744
1-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropan-1-ol (PubChem CID 105096744) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 105096744 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 1-(2,5-dimethylpyrazol-3-yl)-2,2-dimethylpropan-1-ol |
| SMILES | Cc1cc(C(O)C(C)(C)C)n(C)n1 |
| InChI | InChI=1S/C10H18N2O/c1-7-6-8(12(5)11-7)9(13)10(2,3)4/h6,9,13H,1-5H3 |
| InChIKey | OOWMCQWIWMKSEI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |