C9H14N2O — CID 105110508
1-(2,5-dimethylpyrazol-3-yl)-2-methylprop-2-en-1-ol (PubChem CID 105110508) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrazol-3-yl)-2-methylprop-2-en-1-ol.
| Compound Name | 1-(2,5-dimethylpyrazol-3-yl)-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 105110508 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-(2,5-dimethylpyrazol-3-yl)-2-methylprop-2-en-1-ol |
| SMILES | C=C(C)C(O)c1cc(C)nn1C |
| InChI | InChI=1S/C9H14N2O/c1-6(2)9(12)8-5-7(3)10-11(8)4/h5,9,12H,1H2,2-4H3 |
| InChIKey | NNIRDTFWCJYQFL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|