C47H13F19N6 — CID 10510239
10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-5-(2,3,5,6-tetrafluoro-4-pyrazol-1-ylphenyl)-21,22-dihydroporphyrin (PubChem CID 10510239) has the molecular formula C47H13F19N6 and a molecular weight of 1022.62 g/mol. Its IUPAC name is 10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-5-(2,3,5,6-tetrafluoro-4-pyrazol-1-ylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-5-(2,3,5,6-tetrafluoro-4-pyrazol-1-ylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10510239 |
| Molecular Formula | C47H13F19N6 |
| Molecular Weight | 1022.62 g/mol |
| Exact Mass | 1022.09 |
| IUPAC Name | 10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-5-(2,3,5,6-tetrafluoro-4-pyrazol-1-ylphenyl)-21,22-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(-n5cccn5)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc2C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C47H13F19N6/c48-28-24(29(49)37(57)42(62)36(28)56)20-12-2-4-14(68-12)21(25-30(50)38(58)43(63)39(59)31(25)51)16-6-8-18(70-16)23(27-34(54)45(65)47(46(66)35(27)55)72-11-1-10-67-72)19-9-7-17(71-19)22(15-5-3-13(20)69-15)26-32(52)40(60)44(64)41(61)33(26)53/h1-11,70-71H/b20-12+,20-13+,21-14+,21-16+,22-15+,22-17+,23-18+,23-19+ |
| InChIKey | HDZZXIKIGXPOSW-RQZYISBESA-N |
| XLogP | 14.15 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.62 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|