C44H10F20N4 — CID 71431125
10,12,13,23-tetrakis(2,3,4,5,6-pentafluorophenyl)-21H-porphyrin (PubChem CID 71431125) has the molecular formula C44H10F20N4 and a molecular weight of 974.55 g/mol. Its IUPAC name is 10,12,13,23-tetrakis(2,3,4,5,6-pentafluorophenyl)-21H-porphyrin.
| Compound Name | 10,12,13,23-tetrakis(2,3,4,5,6-pentafluorophenyl)-21H-porphyrin |
|---|---|
| PubChem CID | 71431125 |
| Molecular Formula | C44H10F20N4 |
| Molecular Weight | 974.55 g/mol |
| Exact Mass | 974.06 |
| IUPAC Name | 10,12,13,23-tetrakis(2,3,4,5,6-pentafluorophenyl)-21H-porphyrin |
| SMILES | Fc1c(F)c(F)c(-c2c(-c3c(F)c(F)c(F)c(F)c3F)c3c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(cc5ccc(cc6nc(cc2n3-c2c(F)c(F)c(F)c(F)c2F)C=C6)[nH]5)C=C4)c(F)c1F |
| InChI | InChI=1S/C44H10F20N4/c45-23-20(24(46)30(52)35(57)29(23)51)17-15-6-5-13(67-15)8-12-2-1-10(65-12)7-11-3-4-14(66-11)9-16-18(21-25(47)31(53)36(58)32(54)26(21)48)19(22-27(49)33(55)37(59)34(56)28(22)50)43(17)68(16)44-41(63)39(61)38(60)40(62)42(44)64/h1-9,65H/b10-7-,11-7-,12-8-,13-8-,14-9-,16-9-,17-15-,43-17+ |
| InChIKey | LYMVHNBGCIAWOO-FZHHGVEASA-N |
| XLogP | 13.90 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.55 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|