C12H20F2O — CID 105127383
1-(4,4-difluorocyclohexyl)-4-methylpent-4-en-1-ol (PubChem CID 105127383) has the molecular formula C12H20F2O and a molecular weight of 218.29 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-4-methylpent-4-en-1-ol.
| Compound Name | 1-(4,4-difluorocyclohexyl)-4-methylpent-4-en-1-ol |
|---|---|
| PubChem CID | 105127383 |
| Molecular Formula | C12H20F2O |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-4-methylpent-4-en-1-ol |
| SMILES | C=C(C)CCC(O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H20F2O/c1-9(2)3-4-11(15)10-5-7-12(13,14)8-6-10/h10-11,15H,1,3-8H2,2H3 |
| InChIKey | ABGIBMLOXAWJLL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|