C16H32O — CID 177218986
(1R)-1-(4,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-ol (PubChem CID 177218986) has the molecular formula C16H32O and a molecular weight of 240.43 g/mol. Its IUPAC name is (1R)-1-(4,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-ol.
| Compound Name | (1R)-1-(4,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 177218986 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | (1R)-1-(4,4-dimethylcyclohexyl)-5,5-dimethylhexan-1-ol |
| SMILES | CC(C)(C)CCC[C@@H](O)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H32O/c1-15(2,3)10-6-7-14(17)13-8-11-16(4,5)12-9-13/h13-14,17H,6-12H2,1-5H3/t14-/m1/s1 |
| InChIKey | JLXFHHLNQANLAT-CQSZACIVSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |