C10H24OS2 — CID 159744977
(1R)-1-[(1S)-3,3-dimethylcyclopentyl]propan-1-ol;sulfane (PubChem CID 159744977) has the molecular formula C10H24OS2 and a molecular weight of 224.43 g/mol. Its IUPAC name is (1R)-1-[(1S)-3,3-dimethylcyclopentyl]propan-1-ol;sulfane.
| Compound Name | (1R)-1-[(1S)-3,3-dimethylcyclopentyl]propan-1-ol;sulfane |
|---|---|
| PubChem CID | 159744977 |
| Molecular Formula | C10H24OS2 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (1R)-1-[(1S)-3,3-dimethylcyclopentyl]propan-1-ol;sulfane |
| SMILES | CC[C@@H](O)[C@H]1CCC(C)(C)C1.S.S |
| InChI | InChI=1S/C10H20O.2H2S/c1-4-9(11)8-5-6-10(2,3)7-8;;/h8-9,11H,4-7H2,1-3H3;2*1H2/t8-,9+;;/m0../s1 |
| InChIKey | NCXUVDLJHLIUSO-DBEJOZALSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |