C14H17ClO3 — CID 105130466
1-(7-chloro-1-benzofuran-2-yl)-4-ethoxybutan-1-ol (PubChem CID 105130466) has the molecular formula C14H17ClO3 and a molecular weight of 268.74 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-4-ethoxybutan-1-ol.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-4-ethoxybutan-1-ol |
|---|---|
| PubChem CID | 105130466 |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-4-ethoxybutan-1-ol |
| SMILES | CCOCCCC(O)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C14H17ClO3/c1-2-17-8-4-7-12(16)13-9-10-5-3-6-11(15)14(10)18-13/h3,5-6,9,12,16H,2,4,7-8H2,1H3 |
| InChIKey | VOWVITUVUQVVMU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|