C9H12BrNO3 — CID 10515587
methyl 2-(1-bromo-2-methylpropyl)-1,3-oxazole-4-carboxylate (PubChem CID 10515587) has the molecular formula C9H12BrNO3 and a molecular weight of 262.10 g/mol. Its IUPAC name is methyl 2-(1-bromo-2-methylpropyl)-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-(1-bromo-2-methylpropyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 10515587 |
| Molecular Formula | C9H12BrNO3 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | methyl 2-(1-bromo-2-methylpropyl)-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(C(Br)C(C)C)n1 |
| InChI | InChI=1S/C9H12BrNO3/c1-5(2)7(10)8-11-6(4-14-8)9(12)13-3/h4-5,7H,1-3H3 |
| InChIKey | UCHGZGVROHTNDU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|