C11H19F2N — CID 105163123
1-(4,4-difluorocyclohexyl)-3-methylbut-3-en-1-amine (PubChem CID 105163123) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-3-methylbut-3-en-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-3-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 105163123 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-3-methylbut-3-en-1-amine |
| SMILES | C=C(C)CC(N)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H19F2N/c1-8(2)7-10(14)9-3-5-11(12,13)6-4-9/h9-10H,1,3-7,14H2,2H3 |
| InChIKey | WVDUMKBXCKFISV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|