C12H21F2N — CID 105163449
1-(4,4-difluorocyclohexyl)-N,3-dimethylbut-2-en-1-amine (PubChem CID 105163449) has the molecular formula C12H21F2N and a molecular weight of 217.30 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-N,3-dimethylbut-2-en-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-N,3-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 105163449 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-N,3-dimethylbut-2-en-1-amine |
| SMILES | CNC(C=C(C)C)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H21F2N/c1-9(2)8-11(15-3)10-4-6-12(13,14)7-5-10/h8,10-11,15H,4-7H2,1-3H3 |
| InChIKey | JQBLAMWLSZHVEY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|