C11H18F3N — CID 105163805
2-methyl-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-amine (PubChem CID 105163805) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is 2-methyl-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-amine.
| Compound Name | 2-methyl-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 105163805 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-methyl-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-amine |
| SMILES | C=C(C)C(N)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3N/c1-7(2)10(15)8-3-5-9(6-4-8)11(12,13)14/h8-10H,1,3-6,15H2,2H3 |
| InChIKey | GDBDOZDUTXIOQZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|