C12H21F2N — CID 105164066
1-(4,4-difluorocyclohexyl)-3-methylidenepentan-1-amine (PubChem CID 105164066) has the molecular formula C12H21F2N and a molecular weight of 217.30 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-3-methylidenepentan-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-3-methylidenepentan-1-amine |
|---|---|
| PubChem CID | 105164066 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-3-methylidenepentan-1-amine |
| SMILES | C=C(CC)CC(N)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H21F2N/c1-3-9(2)8-11(15)10-4-6-12(13,14)7-5-10/h10-11H,2-8,15H2,1H3 |
| InChIKey | VFGWIEOEQRXNKQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|