C8H8Cl2F3NO2 — CID 10516696
[4-chloro-2-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]azanium chloride (PubChem CID 10516696) has the molecular formula C8H8Cl2F3NO2 and a molecular weight of 278.06 g/mol. Its IUPAC name is [4-chloro-2-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]azanium chloride.
| Compound Name | [4-chloro-2-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]azanium chloride |
|---|---|
| PubChem CID | 10516696 |
| Molecular Formula | C8H8Cl2F3NO2 |
| Molecular Weight | 278.06 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | [4-chloro-2-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]azanium chloride |
| SMILES | [Cl-].[NH3+]c1ccc(Cl)cc1C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C8H7ClF3NO2.ClH/c9-4-1-2-6(13)5(3-4)7(14,15)8(10,11)12;/h1-3,14-15H,13H2;1H |
| InChIKey | SYLRXHNMJUPJDK-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.06 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|