C11H12Cl2F3NO — CID 162547921
(2S)-2-(2-amino-5-chlorophenyl)-5-chloro-1,1,1-trifluoropentan-2-ol (PubChem CID 162547921) has the molecular formula C11H12Cl2F3NO and a molecular weight of 302.12 g/mol. Its IUPAC name is (2S)-2-(2-amino-5-chlorophenyl)-5-chloro-1,1,1-trifluoropentan-2-ol.
| Compound Name | (2S)-2-(2-amino-5-chlorophenyl)-5-chloro-1,1,1-trifluoropentan-2-ol |
|---|---|
| PubChem CID | 162547921 |
| Molecular Formula | C11H12Cl2F3NO |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | (2S)-2-(2-amino-5-chlorophenyl)-5-chloro-1,1,1-trifluoropentan-2-ol |
| SMILES | Nc1ccc(Cl)cc1[C@@](O)(CCCCl)C(F)(F)F |
| InChI | InChI=1S/C11H12Cl2F3NO/c12-5-1-4-10(18,11(14,15)16)8-6-7(13)2-3-9(8)17/h2-3,6,18H,1,4-5,17H2/t10-/m0/s1 |
| InChIKey | CZLZSOUPIGSAHH-JTQLQIEISA-N |
| XLogP | 3.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|