C17H21NO3 — CID 10517395
benzyl (6Z)-10-oxo-2,3,4,5,8,9-hexahydroazecine-1-carboxylate (PubChem CID 10517395) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is benzyl (6Z)-10-oxo-2,3,4,5,8,9-hexahydroazecine-1-carboxylate.
| Compound Name | benzyl (6Z)-10-oxo-2,3,4,5,8,9-hexahydroazecine-1-carboxylate |
|---|---|
| PubChem CID | 10517395 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | benzyl (6Z)-10-oxo-2,3,4,5,8,9-hexahydroazecine-1-carboxylate |
| SMILES | O=C1CC/C=C\CCCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H21NO3/c19-16-12-8-3-1-2-4-9-13-18(16)17(20)21-14-15-10-6-5-7-11-15/h1,3,5-7,10-11H,2,4,8-9,12-14H2/b3-1- |
| InChIKey | AZCDXRCCFKLLED-IWQZZHSRSA-N |
| XLogP | 3.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|