C16H26O6 — CID 10519332
ethyl (2Z)-2-[(4S,6R)-4-(3-acetyloxybutyl)-6-methoxyoxan-3-ylidene]acetate (PubChem CID 10519332) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is ethyl (2Z)-2-[(4S,6R)-4-(3-acetyloxybutyl)-6-methoxyoxan-3-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(4S,6R)-4-(3-acetyloxybutyl)-6-methoxyoxan-3-ylidene]acetate |
|---|---|
| PubChem CID | 10519332 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | ethyl (2Z)-2-[(4S,6R)-4-(3-acetyloxybutyl)-6-methoxyoxan-3-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CO[C@@H](OC)C[C@@H]1CCC(C)OC(C)=O |
| InChI | InChI=1S/C16H26O6/c1-5-20-15(18)8-14-10-21-16(19-4)9-13(14)7-6-11(2)22-12(3)17/h8,11,13,16H,5-7,9-10H2,1-4H3/b14-8+/t11?,13-,16+/m0/s1 |
| InChIKey | DOWNQXAUOAYULB-PXDXLJGSSA-N |
| XLogP | 2.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|