C24H40O6 — CID 134931268
methyl (2E,4R,5E,7S,8E,12S,13R)-13-hydroxy-7-methoxy-4,8,12-trimethyl-4-(oxan-2-yloxy)tetradeca-2,5,8-trienoate (PubChem CID 134931268) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is methyl (2E,4R,5E,7S,8E,12S,13R)-13-hydroxy-7-methoxy-4,8,12-trimethyl-4-(oxan-2-yloxy)tetradeca-2,5,8-trienoate.
| Compound Name | methyl (2E,4R,5E,7S,8E,12S,13R)-13-hydroxy-7-methoxy-4,8,12-trimethyl-4-(oxan-2-yloxy)tetradeca-2,5,8-trienoate |
|---|---|
| PubChem CID | 134931268 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | methyl (2E,4R,5E,7S,8E,12S,13R)-13-hydroxy-7-methoxy-4,8,12-trimethyl-4-(oxan-2-yloxy)tetradeca-2,5,8-trienoate |
| SMILES | COC(=O)/C=C/[C@@](C)(/C=C/[C@H](OC)/C(C)=C/CC[C@H](C)[C@@H](C)O)OC1CCCCO1 |
| InChI | InChI=1S/C24H40O6/c1-18(20(3)25)10-9-11-19(2)21(27-5)13-15-24(4,16-14-22(26)28-6)30-23-12-7-8-17-29-23/h11,13-16,18,20-21,23,25H,7-10,12,17H2,1-6H3/b15-13+,16-14+,19-11+/t18-,20+,21-,23?,24+/m0/s1 |
| InChIKey | AQKMPAHAYYEREX-FRQUMTMGSA-N |
| XLogP | 4.33 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|