C18H22N2O3 — CID 10519337
(1R,10S)-4,6,9,9-tetramethyl-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-2(7),13,15,17-tetraen-3-one (PubChem CID 10519337) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1R,10S)-4,6,9,9-tetramethyl-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-2(7),13,15,17-tetraen-3-one.
| Compound Name | (1R,10S)-4,6,9,9-tetramethyl-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-2(7),13,15,17-tetraen-3-one |
|---|---|
| PubChem CID | 10519337 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (1R,10S)-4,6,9,9-tetramethyl-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-2(7),13,15,17-tetraen-3-one |
| SMILES | CN1CN(C)C2=C(C1=O)[C@H]1c3ccccc3OC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C18H22N2O3/c1-18(2)12-9-22-13-8-6-5-7-11(13)14(12)15-16(21)19(3)10-20(4)17(15)23-18/h5-8,12,14H,9-10H2,1-4H3/t12-,14+/m1/s1 |
| InChIKey | RCOSHFOAFRJBAE-OCCSQVGLSA-N |
| XLogP | 2.16 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |