C15H26N2O2 — CID 105199088
[1-(3,4-diethoxyphenyl)-3-methylbutyl]hydrazine (PubChem CID 105199088) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is [1-(3,4-diethoxyphenyl)-3-methylbutyl]hydrazine.
| Compound Name | [1-(3,4-diethoxyphenyl)-3-methylbutyl]hydrazine |
|---|---|
| PubChem CID | 105199088 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | [1-(3,4-diethoxyphenyl)-3-methylbutyl]hydrazine |
| SMILES | CCOc1ccc(C(CC(C)C)NN)cc1OCC |
| InChI | InChI=1S/C15H26N2O2/c1-5-18-14-8-7-12(10-15(14)19-6-2)13(17-16)9-11(3)4/h7-8,10-11,13,17H,5-6,9,16H2,1-4H3 |
| InChIKey | QLEOWNVDKUCBPR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|