C13H18N2O2 — CID 105315456
1-(3,4-diethoxyphenyl)prop-2-ynylhydrazine (PubChem CID 105315456) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)prop-2-ynylhydrazine.
| Compound Name | 1-(3,4-diethoxyphenyl)prop-2-ynylhydrazine |
|---|---|
| PubChem CID | 105315456 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)prop-2-ynylhydrazine |
| SMILES | C#CC(NN)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C13H18N2O2/c1-4-11(15-14)10-7-8-12(16-5-2)13(9-10)17-6-3/h1,7-9,11,15H,5-6,14H2,2-3H3 |
| InChIKey | SMMWPMSMXHLWPP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|