C16H13F3N2O3 — CID 10520962
2,2-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-6-(trifluoromethoxy)-1,3-benzoxazine (PubChem CID 10520962) has the molecular formula C16H13F3N2O3 and a molecular weight of 338.29 g/mol. Its IUPAC name is 2,2-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-6-(trifluoromethoxy)-1,3-benzoxazine.
| Compound Name | 2,2-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-6-(trifluoromethoxy)-1,3-benzoxazine |
|---|---|
| PubChem CID | 10520962 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2,2-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-6-(trifluoromethoxy)-1,3-benzoxazine |
| SMILES | CC1(C)N=C(c2cccc[n+]2[O-])c2cc(OC(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C16H13F3N2O3/c1-15(2)20-14(12-5-3-4-8-21(12)22)11-9-10(23-16(17,18)19)6-7-13(11)24-15/h3-9H,1-2H3 |
| InChIKey | ZVNHAUSOSJJLMD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|