C16H23N5 — CID 105217181
[1-(1-phenylcyclopropyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105217181) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is [1-(1-phenylcyclopropyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(1-phenylcyclopropyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105217181 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | [1-(1-phenylcyclopropyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CC(C)n1ncnc1CC(NN)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H23N5/c1-12(2)21-15(18-11-19-21)10-14(20-17)16(8-9-16)13-6-4-3-5-7-13/h3-7,11-12,14,20H,8-10,17H2,1-2H3 |
| InChIKey | QTUQIJRHSAPVNO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|