C13H23F2N5 — CID 105317373
[1-(4,4-difluorocyclohexyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105317373) has the molecular formula C13H23F2N5 and a molecular weight of 287.36 g/mol. Its IUPAC name is [1-(4,4-difluorocyclohexyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(4,4-difluorocyclohexyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105317373 |
| Molecular Formula | C13H23F2N5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | [1-(4,4-difluorocyclohexyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CC(C)n1ncnc1CC(NN)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H23F2N5/c1-9(2)20-12(17-8-18-20)7-11(19-16)10-3-5-13(14,15)6-4-10/h8-11,19H,3-7,16H2,1-2H3 |
| InChIKey | BQDBGWJUHAHPDU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|