C22H24N2O3 — CID 10522796
3-[(1R,4S)-3-(3-oxo-3-piperidin-1-ylprop-1-ynyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-piperidin-1-ylprop-2-yn-1-one (PubChem CID 10522796) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[(1R,4S)-3-(3-oxo-3-piperidin-1-ylprop-1-ynyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-piperidin-1-ylprop-2-yn-1-one.
| Compound Name | 3-[(1R,4S)-3-(3-oxo-3-piperidin-1-ylprop-1-ynyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-piperidin-1-ylprop-2-yn-1-one |
|---|---|
| PubChem CID | 10522796 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-[(1R,4S)-3-(3-oxo-3-piperidin-1-ylprop-1-ynyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-piperidin-1-ylprop-2-yn-1-one |
| SMILES | O=C(C#CC1=C(C#CC(=O)N2CCCCC2)[C@H]2C=C[C@@H]1O2)N1CCCCC1 |
| InChI | InChI=1S/C22H24N2O3/c25-21(23-13-3-1-4-14-23)11-7-17-18(20-10-9-19(17)27-20)8-12-22(26)24-15-5-2-6-16-24/h9-10,19-20H,1-6,13-16H2/t19-,20+ |
| InChIKey | SGKRFGUJMJJAKU-BGYRXZFFSA-N |
| XLogP | 1.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|